C29H30F6N4O5 — CID 91489010
(2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-methoxyethoxy)-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid (PubChem CID 91489010) has the molecular formula C29H30F6N4O5 and a molecular weight of 628.57 g/mol. Its IUPAC name is (2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-methoxyethoxy)-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid.
| Compound Name | (2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-methoxyethoxy)-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 91489010 |
| Molecular Formula | C29H30F6N4O5 |
| Molecular Weight | 628.57 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | (2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-methoxyethoxy)-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid |
| SMILES | CC[C@@H]1C[C@H](Nc2ncc(OCCOC)cc2Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2nc(OC)ccc2N1C(=O)O |
| InChI | InChI=1S/C29H30F6N4O5/c1-4-20-14-22(25-23(39(20)27(40)41)5-6-24(38-25)43-3)37-26-17(12-21(15-36-26)44-8-7-42-2)9-16-10-18(28(30,31)32)13-19(11-16)29(33,34)35/h5-6,10-13,15,20,22H,4,7-9,14H2,1-3H3,(H,36,37)(H,40,41)/t20-,22+/m1/s1 |
| InChIKey | PVUWDWGSYKOLDL-IRLDBZIGSA-N |
| XLogP | 6.96 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.57 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|