C18H23N5O7 — CID 91489119
8-(2-hydroxyethylamino)-7-methyl-10-(2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4-dione (PubChem CID 91489119) has the molecular formula C18H23N5O7 and a molecular weight of 421.41 g/mol. Its IUPAC name is 8-(2-hydroxyethylamino)-7-methyl-10-(2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4-dione.
| Compound Name | 8-(2-hydroxyethylamino)-7-methyl-10-(2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 91489119 |
| Molecular Formula | C18H23N5O7 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 8-(2-hydroxyethylamino)-7-methyl-10-(2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC(O)C(O)C(O)CO)c2cc1NCCO |
| InChI | InChI=1S/C18H23N5O7/c1-8-4-10-11(5-9(8)19-2-3-24)23(6-12(26)15(28)13(27)7-25)16-14(20-10)17(29)22-18(30)21-16/h4-5,12-13,15,19,24-28H,2-3,6-7H2,1H3,(H,22,29,30) |
| InChIKey | STYHKSJAZBOYGZ-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 193.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|