C28H25FN4O2S — CID 91489232
methyl 2-[(9S)-7-[4-[2-(4-fluorophenyl)ethenyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate (PubChem CID 91489232) has the molecular formula C28H25FN4O2S and a molecular weight of 500.60 g/mol. Its IUPAC name is methyl 2-[(9S)-7-[4-[2-(4-fluorophenyl)ethenyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate.
| Compound Name | methyl 2-[(9S)-7-[4-[2-(4-fluorophenyl)ethenyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
|---|---|
| PubChem CID | 91489232 |
| Molecular Formula | C28H25FN4O2S |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | methyl 2-[(9S)-7-[4-[2-(4-fluorophenyl)ethenyl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
| SMILES | COC(=O)C[C@@H]1N=C(c2ccc(C=Cc3ccc(F)cc3)cc2)c2c(sc(C)c2C)-n2c(C)nnc21 |
| InChI | InChI=1S/C28H25FN4O2S/c1-16-17(2)36-28-25(16)26(30-23(15-24(34)35-4)27-32-31-18(3)33(27)28)21-11-7-19(8-12-21)5-6-20-9-13-22(29)14-10-20/h5-14,23H,15H2,1-4H3/t23-/m0/s1 |
| InChIKey | IXFZRAZUJPKIGA-QHCPKHFHSA-N |
| XLogP | 6.02 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|