About N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzenesulfonamide
N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzenesulfonamide (PubChem CID 91489416) has the molecular formula C29H34N2O2S
and a molecular weight of 474.67 g/mol. Its IUPAC name is N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzenesulfonamide |
| PubChem CID | 91489416 |
| Molecular Formula | C29H34N2O2S |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1)N(c1ccccc1)C1CCN([C@@H]2CCCC[C@@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C29H34N2O2S/c32-34(33,27-16-8-3-9-17-27)31(25-14-6-2-7-15-25)26-20-22-30(23-21-26)29-19-11-10-18-28(29)24-12-4-1-5-13-24/h1-9,12-17,26,28-29H,10-11,18-23H2/t28-,29-/m1/s1 |
| InChIKey | QYMXCVQMAAMQMM-FQLXRVMXSA-N |
| XLogP | 6.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzenesulfonamide?
The IUPAC name of N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzenesulfonamide (CID 91489416) is N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzenesulfonamide.
What is the SMILES notation for N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzenesulfonamide?
The canonical SMILES for N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzenesulfonamide is O=S(=O)(c1ccccc1)N(c1ccccc1)C1CCN([C@@H]2CCCC[C@@H]2c2ccccc2)CC1.
What is the InChIKey of N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzenesulfonamide?
The InChIKey is QYMXCVQMAAMQMM-FQLXRVMXSA-N. The full InChI is InChI=1S/C29H34N2O2S/c32-34(33,27-16-8-3-9-17-27)31(25-14-6-2-7-15-25)26-20-22-30(23-21-26)29-19-11-10-18-28(29)24-12-4-1-5-13-24/h1-9,12-17,26,28-29H,10-11,18-23H2/t28-,29-/m1/s1.
What are the key properties of N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzenesulfonamide?
N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzenesulfonamide has a molecular weight of 474.67 g/mol, XLogP of 6.07, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzenesulfonamide is sourced from PubChem (CID 91489416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).