About 8-(1,2,4-triazol-1-yl)octan-3-ol
8-(1,2,4-triazol-1-yl)octan-3-ol (PubChem CID 91489718) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is 8-(1,2,4-triazol-1-yl)octan-3-ol.
Molecular Properties
| Compound Name | 8-(1,2,4-triazol-1-yl)octan-3-ol |
| PubChem CID | 91489718 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 8-(1,2,4-triazol-1-yl)octan-3-ol |
| SMILES | CCC(O)CCCCCn1cncn1 |
| InChI | InChI=1S/C10H19N3O/c1-2-10(14)6-4-3-5-7-13-9-11-8-12-13/h8-10,14H,2-7H2,1H3 |
| InChIKey | GBAGXAGZOZKLQX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-(1,2,4-triazol-1-yl)octan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1,2,4-triazol-1-yl)octan-3-ol?
The IUPAC name of 8-(1,2,4-triazol-1-yl)octan-3-ol (CID 91489718) is 8-(1,2,4-triazol-1-yl)octan-3-ol.
What is the SMILES notation for 8-(1,2,4-triazol-1-yl)octan-3-ol?
The canonical SMILES for 8-(1,2,4-triazol-1-yl)octan-3-ol is CCC(O)CCCCCn1cncn1.
What is the InChIKey of 8-(1,2,4-triazol-1-yl)octan-3-ol?
The InChIKey is GBAGXAGZOZKLQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O/c1-2-10(14)6-4-3-5-7-13-9-11-8-12-13/h8-10,14H,2-7H2,1H3.
What are the key properties of 8-(1,2,4-triazol-1-yl)octan-3-ol?
8-(1,2,4-triazol-1-yl)octan-3-ol has a molecular weight of 197.28 g/mol, XLogP of 1.61, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1,2,4-triazol-1-yl)octan-3-ol is sourced from PubChem (CID 91489718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).