About 6-(ethylaminomethyl)-2,3-difluoro-2,5-dimethyloxan-4-ol
6-(ethylaminomethyl)-2,3-difluoro-2,5-dimethyloxan-4-ol (PubChem CID 91490285) has the molecular formula C10H19F2NO2
and a molecular weight of 223.26 g/mol. Its IUPAC name is 6-(ethylaminomethyl)-2,3-difluoro-2,5-dimethyloxan-4-ol.
Molecular Properties
| Compound Name | 6-(ethylaminomethyl)-2,3-difluoro-2,5-dimethyloxan-4-ol |
| PubChem CID | 91490285 |
| Molecular Formula | C10H19F2NO2 |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 6-(ethylaminomethyl)-2,3-difluoro-2,5-dimethyloxan-4-ol |
| SMILES | CCNCC1OC(C)(F)C(F)C(O)C1C |
| InChI | InChI=1S/C10H19F2NO2/c1-4-13-5-7-6(2)8(14)9(11)10(3,12)15-7/h6-9,13-14H,4-5H2,1-3H3 |
| InChIKey | FQPCESQNJVMZHO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(ethylaminomethyl)-2,3-difluoro-2,5-dimethyloxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(ethylaminomethyl)-2,3-difluoro-2,5-dimethyloxan-4-ol?
The IUPAC name of 6-(ethylaminomethyl)-2,3-difluoro-2,5-dimethyloxan-4-ol (CID 91490285) is 6-(ethylaminomethyl)-2,3-difluoro-2,5-dimethyloxan-4-ol.
What is the SMILES notation for 6-(ethylaminomethyl)-2,3-difluoro-2,5-dimethyloxan-4-ol?
The canonical SMILES for 6-(ethylaminomethyl)-2,3-difluoro-2,5-dimethyloxan-4-ol is CCNCC1OC(C)(F)C(F)C(O)C1C.
What is the InChIKey of 6-(ethylaminomethyl)-2,3-difluoro-2,5-dimethyloxan-4-ol?
The InChIKey is FQPCESQNJVMZHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F2NO2/c1-4-13-5-7-6(2)8(14)9(11)10(3,12)15-7/h6-9,13-14H,4-5H2,1-3H3.
What are the key properties of 6-(ethylaminomethyl)-2,3-difluoro-2,5-dimethyloxan-4-ol?
6-(ethylaminomethyl)-2,3-difluoro-2,5-dimethyloxan-4-ol has a molecular weight of 223.26 g/mol, XLogP of 1.02, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(ethylaminomethyl)-2,3-difluoro-2,5-dimethyloxan-4-ol is sourced from PubChem (CID 91490285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).