C13H19ClN2 — CID 91490292
N'-(2-chlorophenyl)-N-(cyclopropylmethyl)propane-1,3-diamine (PubChem CID 91490292) has the molecular formula C13H19ClN2 and a molecular weight of 238.76 g/mol. Its IUPAC name is N'-(2-chlorophenyl)-N-(cyclopropylmethyl)propane-1,3-diamine.
| Compound Name | N'-(2-chlorophenyl)-N-(cyclopropylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 91490292 |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | N'-(2-chlorophenyl)-N-(cyclopropylmethyl)propane-1,3-diamine |
| SMILES | Clc1ccccc1NCCCNCC1CC1 |
| InChI | InChI=1S/C13H19ClN2/c14-12-4-1-2-5-13(12)16-9-3-8-15-10-11-6-7-11/h1-2,4-5,11,15-16H,3,6-10H2 |
| InChIKey | JKSKLTSVFXAPEF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|