C26H28N2O3 — CID 9149042
N-[(1S)-2-morpholin-4-yl-1-phenylethyl]-2-(4-phenylphenoxy)acetamide (PubChem CID 9149042) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is N-[(1S)-2-morpholin-4-yl-1-phenylethyl]-2-(4-phenylphenoxy)acetamide.
| Compound Name | N-[(1S)-2-morpholin-4-yl-1-phenylethyl]-2-(4-phenylphenoxy)acetamide |
|---|---|
| PubChem CID | 9149042 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-[(1S)-2-morpholin-4-yl-1-phenylethyl]-2-(4-phenylphenoxy)acetamide |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1)N[C@H](CN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O3/c29-26(20-31-24-13-11-22(12-14-24)21-7-3-1-4-8-21)27-25(23-9-5-2-6-10-23)19-28-15-17-30-18-16-28/h1-14,25H,15-20H2,(H,27,29)/t25-/m1/s1 |
| InChIKey | AEVBCCWJWGGAKL-RUZDIDTESA-N |
| XLogP | 3.92 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |