C25H40O5S — CID 91491087
4-[[2-(4,8-dimethylnon-1-enyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]butane-1-sulfonic acid (PubChem CID 91491087) has the molecular formula C25H40O5S and a molecular weight of 452.66 g/mol. Its IUPAC name is 4-[[2-(4,8-dimethylnon-1-enyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]butane-1-sulfonic acid.
| Compound Name | 4-[[2-(4,8-dimethylnon-1-enyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 91491087 |
| Molecular Formula | C25H40O5S |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 4-[[2-(4,8-dimethylnon-1-enyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]butane-1-sulfonic acid |
| SMILES | CC(C)CCCC(C)CC=CC1(C)CCc2cc(OCCCCS(=O)(=O)O)ccc2O1 |
| InChI | InChI=1S/C25H40O5S/c1-20(2)9-7-10-21(3)11-8-15-25(4)16-14-22-19-23(12-13-24(22)30-25)29-17-5-6-18-31(26,27)28/h8,12-13,15,19-21H,5-7,9-11,14,16-18H2,1-4H3,(H,26,27,28) |
| InChIKey | MREPUOCFROXQEK-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|