About 2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-ol
2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-ol (PubChem CID 91491462) has the molecular formula C14H24N4OS
and a molecular weight of 296.44 g/mol. Its IUPAC name is 2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-ol.
Molecular Properties
| Compound Name | 2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-ol |
| PubChem CID | 91491462 |
| Molecular Formula | C14H24N4OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-ol |
| SMILES | CN1CCC(CN2CCN(c3nc(O)cs3)CC2)CC1 |
| InChI | InChI=1S/C14H24N4OS/c1-16-4-2-12(3-5-16)10-17-6-8-18(9-7-17)14-15-13(19)11-20-14/h11-12,19H,2-10H2,1H3 |
| InChIKey | ROKRRJKUFGXRLF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-ol?
The IUPAC name of 2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-ol (CID 91491462) is 2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-ol.
What is the SMILES notation for 2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-ol?
The canonical SMILES for 2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-ol is CN1CCC(CN2CCN(c3nc(O)cs3)CC2)CC1.
What is the InChIKey of 2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-ol?
The InChIKey is ROKRRJKUFGXRLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4OS/c1-16-4-2-12(3-5-16)10-17-6-8-18(9-7-17)14-15-13(19)11-20-14/h11-12,19H,2-10H2,1H3.
What are the key properties of 2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-ol?
2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-ol has a molecular weight of 296.44 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-1,3-thiazol-4-ol is sourced from PubChem (CID 91491462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).