About 4-(diethylamino)-2-(dimethylamino)butane-1,3-dithiol
4-(diethylamino)-2-(dimethylamino)butane-1,3-dithiol (PubChem CID 91491511) has the molecular formula C10H24N2S2
and a molecular weight of 236.45 g/mol. Its IUPAC name is 4-(diethylamino)-2-(dimethylamino)butane-1,3-dithiol.
Molecular Properties
| Compound Name | 4-(diethylamino)-2-(dimethylamino)butane-1,3-dithiol |
| PubChem CID | 91491511 |
| Molecular Formula | C10H24N2S2 |
| Molecular Weight | 236.45 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 4-(diethylamino)-2-(dimethylamino)butane-1,3-dithiol |
| SMILES | CCN(CC)CC(S)C(CS)N(C)C |
| InChI | InChI=1S/C10H24N2S2/c1-5-12(6-2)7-10(14)9(8-13)11(3)4/h9-10,13-14H,5-8H2,1-4H3 |
| InChIKey | YSDHKIHLGLJHLW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethylamino)-2-(dimethylamino)butane-1,3-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethylamino)-2-(dimethylamino)butane-1,3-dithiol?
The IUPAC name of 4-(diethylamino)-2-(dimethylamino)butane-1,3-dithiol (CID 91491511) is 4-(diethylamino)-2-(dimethylamino)butane-1,3-dithiol.
What is the SMILES notation for 4-(diethylamino)-2-(dimethylamino)butane-1,3-dithiol?
The canonical SMILES for 4-(diethylamino)-2-(dimethylamino)butane-1,3-dithiol is CCN(CC)CC(S)C(CS)N(C)C.
What is the InChIKey of 4-(diethylamino)-2-(dimethylamino)butane-1,3-dithiol?
The InChIKey is YSDHKIHLGLJHLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2S2/c1-5-12(6-2)7-10(14)9(8-13)11(3)4/h9-10,13-14H,5-8H2,1-4H3.
What are the key properties of 4-(diethylamino)-2-(dimethylamino)butane-1,3-dithiol?
4-(diethylamino)-2-(dimethylamino)butane-1,3-dithiol has a molecular weight of 236.45 g/mol, XLogP of 1.49, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethylamino)-2-(dimethylamino)butane-1,3-dithiol is sourced from PubChem (CID 91491511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).