C25H42O2 — CID 91491641
(2,2-dimethyl-3-propan-2-ylidenecyclobutyl)methyl 2,9-dimethyl-6-prop-1-en-2-yldec-8-enoate (PubChem CID 91491641) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is (2,2-dimethyl-3-propan-2-ylidenecyclobutyl)methyl 2,9-dimethyl-6-prop-1-en-2-yldec-8-enoate.
| Compound Name | (2,2-dimethyl-3-propan-2-ylidenecyclobutyl)methyl 2,9-dimethyl-6-prop-1-en-2-yldec-8-enoate |
|---|---|
| PubChem CID | 91491641 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | (2,2-dimethyl-3-propan-2-ylidenecyclobutyl)methyl 2,9-dimethyl-6-prop-1-en-2-yldec-8-enoate |
| SMILES | C=C(C)C(CC=C(C)C)CCCC(C)C(=O)OCC1CC(=C(C)C)C1(C)C |
| InChI | InChI=1S/C25H42O2/c1-17(2)13-14-21(18(3)4)12-10-11-20(7)24(26)27-16-22-15-23(19(5)6)25(22,8)9/h13,20-22H,3,10-12,14-16H2,1-2,4-9H3 |
| InChIKey | PLDCZLINYURECK-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|