C7H16O6 — CID 91491767
(2R,3S,4S)-5-(2-hydroxyethoxy)pentane-1,2,3,4-tetrol (PubChem CID 91491767) has the molecular formula C7H16O6 and a molecular weight of 196.20 g/mol. Its IUPAC name is (2R,3S,4S)-5-(2-hydroxyethoxy)pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3S,4S)-5-(2-hydroxyethoxy)pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 91491767 |
| Molecular Formula | C7H16O6 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (2R,3S,4S)-5-(2-hydroxyethoxy)pentane-1,2,3,4-tetrol |
| SMILES | OCCOC[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H16O6/c8-1-2-13-4-6(11)7(12)5(10)3-9/h5-12H,1-4H2/t5-,6+,7+/m1/s1 |
| InChIKey | VLGVTTJRUSSTSA-VQVTYTSYSA-N |
| XLogP | -2.93 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|