About 1-(4,5-dimethyl-2-nitrophenyl)ethyl N-methylcarbamate;methylimino(oxo)methane
1-(4,5-dimethyl-2-nitrophenyl)ethyl N-methylcarbamate;methylimino(oxo)methane (PubChem CID 91492158) has the molecular formula C14H19N3O5
and a molecular weight of 309.32 g/mol. Its IUPAC name is 1-(4,5-dimethyl-2-nitrophenyl)ethyl N-methylcarbamate;methylimino(oxo)methane.
Molecular Properties
| Compound Name | 1-(4,5-dimethyl-2-nitrophenyl)ethyl N-methylcarbamate;methylimino(oxo)methane |
| PubChem CID | 91492158 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-(4,5-dimethyl-2-nitrophenyl)ethyl N-methylcarbamate;methylimino(oxo)methane |
| SMILES | CN=C=O.CNC(=O)OC(C)c1cc(C)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N2O4.C2H3NO/c1-7-5-10(9(3)18-12(15)13-4)11(14(16)17)6-8(7)2;1-3-2-4/h5-6,9H,1-4H3,(H,13,15);1H3 |
| InChIKey | QJJACTIDTNGLIJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,5-dimethyl-2-nitrophenyl)ethyl N-methylcarbamate;methylimino(oxo)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dimethyl-2-nitrophenyl)ethyl N-methylcarbamate;methylimino(oxo)methane?
The IUPAC name of 1-(4,5-dimethyl-2-nitrophenyl)ethyl N-methylcarbamate;methylimino(oxo)methane (CID 91492158) is 1-(4,5-dimethyl-2-nitrophenyl)ethyl N-methylcarbamate;methylimino(oxo)methane.
What is the SMILES notation for 1-(4,5-dimethyl-2-nitrophenyl)ethyl N-methylcarbamate;methylimino(oxo)methane?
The canonical SMILES for 1-(4,5-dimethyl-2-nitrophenyl)ethyl N-methylcarbamate;methylimino(oxo)methane is CN=C=O.CNC(=O)OC(C)c1cc(C)c(C)cc1[N+](=O)[O-].
What is the InChIKey of 1-(4,5-dimethyl-2-nitrophenyl)ethyl N-methylcarbamate;methylimino(oxo)methane?
The InChIKey is QJJACTIDTNGLIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4.C2H3NO/c1-7-5-10(9(3)18-12(15)13-4)11(14(16)17)6-8(7)2;1-3-2-4/h5-6,9H,1-4H3,(H,13,15);1H3.
What are the key properties of 1-(4,5-dimethyl-2-nitrophenyl)ethyl N-methylcarbamate;methylimino(oxo)methane?
1-(4,5-dimethyl-2-nitrophenyl)ethyl N-methylcarbamate;methylimino(oxo)methane has a molecular weight of 309.32 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dimethyl-2-nitrophenyl)ethyl N-methylcarbamate;methylimino(oxo)methane is sourced from PubChem (CID 91492158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).