C32H42N4O5 — CID 91492486
6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[5-ethyl-4-hydroxy-2-(2-methylpropoxy)phenyl]ethyl]oxane-2,4-dione (PubChem CID 91492486) has the molecular formula C32H42N4O5 and a molecular weight of 562.71 g/mol. Its IUPAC name is 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[5-ethyl-4-hydroxy-2-(2-methylpropoxy)phenyl]ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[5-ethyl-4-hydroxy-2-(2-methylpropoxy)phenyl]ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91492486 |
| Molecular Formula | C32H42N4O5 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.32 |
| IUPAC Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[5-ethyl-4-hydroxy-2-(2-methylpropoxy)phenyl]ethyl]oxane-2,4-dione |
| SMILES | CCc1cc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4nc(C)cc(C)n4n3)C(=O)O2)c(OCC(C)C)cc1O |
| InChI | InChI=1S/C32H42N4O5/c1-6-22-14-23(28(16-26(22)37)40-18-19(2)3)11-12-32(24-9-7-8-10-24)17-27(38)25(30(39)41-32)15-29-34-31-33-20(4)13-21(5)36(31)35-29/h13-14,16,19,24-25,37H,6-12,15,17-18H2,1-5H3 |
| InChIKey | AKADCPWJWMGUND-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|