C18H22F2N2O3 — CID 91492507
2-[3-[3-(aminomethylideneamino)cyclobutyl]phenyl]-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxyacetic acid (PubChem CID 91492507) has the molecular formula C18H22F2N2O3 and a molecular weight of 352.38 g/mol. Its IUPAC name is 2-[3-[3-(aminomethylideneamino)cyclobutyl]phenyl]-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxyacetic acid.
| Compound Name | 2-[3-[3-(aminomethylideneamino)cyclobutyl]phenyl]-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 91492507 |
| Molecular Formula | C18H22F2N2O3 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-[3-[3-(aminomethylideneamino)cyclobutyl]phenyl]-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxyacetic acid |
| SMILES | N/C=N/C1CC(c2cccc(C(O)(C(=O)O)[C@@H]3CCC(F)(F)C3)c2)C1 |
| InChI | InChI=1S/C18H22F2N2O3/c19-17(20)5-4-14(9-17)18(25,16(23)24)13-3-1-2-11(6-13)12-7-15(8-12)22-10-21/h1-3,6,10,12,14-15,25H,4-5,7-9H2,(H2,21,22)(H,23,24)/t12?,14-,15?,18?/m1/s1 |
| InChIKey | VPYKYSVJQJIJKV-WDANJUPASA-N |
| XLogP | 2.63 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|