C31H43N3O5S — CID 91492558
4-[4-[1-[3-[(2-benzyl-1,3-dioxol-4-yl)sulfonyl]phenyl]propan-2-yl-propylamino]butyl]-1,4-diazepan-2-one (PubChem CID 91492558) has the molecular formula C31H43N3O5S and a molecular weight of 569.77 g/mol. Its IUPAC name is 4-[4-[1-[3-[(2-benzyl-1,3-dioxol-4-yl)sulfonyl]phenyl]propan-2-yl-propylamino]butyl]-1,4-diazepan-2-one.
| Compound Name | 4-[4-[1-[3-[(2-benzyl-1,3-dioxol-4-yl)sulfonyl]phenyl]propan-2-yl-propylamino]butyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 91492558 |
| Molecular Formula | C31H43N3O5S |
| Molecular Weight | 569.77 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | 4-[4-[1-[3-[(2-benzyl-1,3-dioxol-4-yl)sulfonyl]phenyl]propan-2-yl-propylamino]butyl]-1,4-diazepan-2-one |
| SMILES | CCCN(CCCCN1CCCNC(=O)C1)C(C)Cc1cccc(S(=O)(=O)C2=COC(Cc3ccccc3)O2)c1 |
| InChI | InChI=1S/C31H43N3O5S/c1-3-16-34(19-8-7-17-33-18-10-15-32-29(35)23-33)25(2)20-27-13-9-14-28(21-27)40(36,37)31-24-38-30(39-31)22-26-11-5-4-6-12-26/h4-6,9,11-14,21,24-25,30H,3,7-8,10,15-20,22-23H2,1-2H3,(H,32,35) |
| InChIKey | BSRVZXZMSPKRRF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.77 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|