About 1-methoxy-2-(1,2,4-triazol-1-yl)ethanamine
1-methoxy-2-(1,2,4-triazol-1-yl)ethanamine (PubChem CID 91492636) has the molecular formula C5H9N4O-
and a molecular weight of 141.15 g/mol. Its IUPAC name is 1-methoxy-2-(1,2,4-triazol-1-yl)ethanamine.
Molecular Properties
| Compound Name | 1-methoxy-2-(1,2,4-triazol-1-yl)ethanamine |
| PubChem CID | 91492636 |
| Molecular Formula | C5H9N4O- |
| Molecular Weight | 141.15 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 1-methoxy-2-(1,2,4-triazol-1-yl)ethanamine |
| SMILES | CO[C-](N)Cn1cncn1 |
| InChI | InChI=1S/C5H9N4O/c1-10-5(6)2-9-4-7-3-8-9/h3-4H,2,6H2,1H3/q-1 |
| InChIKey | IZTKHGOJVGGDTJ-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.15 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-2-(1,2,4-triazol-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2-(1,2,4-triazol-1-yl)ethanamine?
The IUPAC name of 1-methoxy-2-(1,2,4-triazol-1-yl)ethanamine (CID 91492636) is 1-methoxy-2-(1,2,4-triazol-1-yl)ethanamine.
What is the SMILES notation for 1-methoxy-2-(1,2,4-triazol-1-yl)ethanamine?
The canonical SMILES for 1-methoxy-2-(1,2,4-triazol-1-yl)ethanamine is CO[C-](N)Cn1cncn1.
What is the InChIKey of 1-methoxy-2-(1,2,4-triazol-1-yl)ethanamine?
The InChIKey is IZTKHGOJVGGDTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N4O/c1-10-5(6)2-9-4-7-3-8-9/h3-4H,2,6H2,1H3/q-1.
What are the key properties of 1-methoxy-2-(1,2,4-triazol-1-yl)ethanamine?
1-methoxy-2-(1,2,4-triazol-1-yl)ethanamine has a molecular weight of 141.15 g/mol, XLogP of -0.63, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2-(1,2,4-triazol-1-yl)ethanamine is sourced from PubChem (CID 91492636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).