About 1-(4-methylphenyl)-4-[2,4,6-tris(trifluoromethyl)phenoxy]piperidine
1-(4-methylphenyl)-4-[2,4,6-tris(trifluoromethyl)phenoxy]piperidine (PubChem CID 91492685) has the molecular formula C21H18F9NO
and a molecular weight of 471.36 g/mol. Its IUPAC name is 1-(4-methylphenyl)-4-[2,4,6-tris(trifluoromethyl)phenoxy]piperidine.
Molecular Properties
| Compound Name | 1-(4-methylphenyl)-4-[2,4,6-tris(trifluoromethyl)phenoxy]piperidine |
| PubChem CID | 91492685 |
| Molecular Formula | C21H18F9NO |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 1-(4-methylphenyl)-4-[2,4,6-tris(trifluoromethyl)phenoxy]piperidine |
| SMILES | Cc1ccc(N2CCC(Oc3c(C(F)(F)F)cc(C(F)(F)F)cc3C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C21H18F9NO/c1-12-2-4-14(5-3-12)31-8-6-15(7-9-31)32-18-16(20(25,26)27)10-13(19(22,23)24)11-17(18)21(28,29)30/h2-5,10-11,15H,6-9H2,1H3 |
| InChIKey | QXWJAQVHQYYHBC-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methylphenyl)-4-[2,4,6-tris(trifluoromethyl)phenoxy]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylphenyl)-4-[2,4,6-tris(trifluoromethyl)phenoxy]piperidine?
The IUPAC name of 1-(4-methylphenyl)-4-[2,4,6-tris(trifluoromethyl)phenoxy]piperidine (CID 91492685) is 1-(4-methylphenyl)-4-[2,4,6-tris(trifluoromethyl)phenoxy]piperidine.
What is the SMILES notation for 1-(4-methylphenyl)-4-[2,4,6-tris(trifluoromethyl)phenoxy]piperidine?
The canonical SMILES for 1-(4-methylphenyl)-4-[2,4,6-tris(trifluoromethyl)phenoxy]piperidine is Cc1ccc(N2CCC(Oc3c(C(F)(F)F)cc(C(F)(F)F)cc3C(F)(F)F)CC2)cc1.
What is the InChIKey of 1-(4-methylphenyl)-4-[2,4,6-tris(trifluoromethyl)phenoxy]piperidine?
The InChIKey is QXWJAQVHQYYHBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F9NO/c1-12-2-4-14(5-3-12)31-8-6-15(7-9-31)32-18-16(20(25,26)27)10-13(19(22,23)24)11-17(18)21(28,29)30/h2-5,10-11,15H,6-9H2,1H3.
What are the key properties of 1-(4-methylphenyl)-4-[2,4,6-tris(trifluoromethyl)phenoxy]piperidine?
1-(4-methylphenyl)-4-[2,4,6-tris(trifluoromethyl)phenoxy]piperidine has a molecular weight of 471.36 g/mol, XLogP of 7.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylphenyl)-4-[2,4,6-tris(trifluoromethyl)phenoxy]piperidine is sourced from PubChem (CID 91492685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).