C11H20N2O7 — CID 91492700
2-[4-hydroxy-2-oxo-4-(1,1,2,2-tetrahydroxypropyl)pyrrolidin-1-yl]butanamide (PubChem CID 91492700) has the molecular formula C11H20N2O7 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-[4-hydroxy-2-oxo-4-(1,1,2,2-tetrahydroxypropyl)pyrrolidin-1-yl]butanamide.
| Compound Name | 2-[4-hydroxy-2-oxo-4-(1,1,2,2-tetrahydroxypropyl)pyrrolidin-1-yl]butanamide |
|---|---|
| PubChem CID | 91492700 |
| Molecular Formula | C11H20N2O7 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-[4-hydroxy-2-oxo-4-(1,1,2,2-tetrahydroxypropyl)pyrrolidin-1-yl]butanamide |
| SMILES | CCC(C(N)=O)N1CC(O)(C(O)(O)C(C)(O)O)CC1=O |
| InChI | InChI=1S/C11H20N2O7/c1-3-6(8(12)15)13-5-10(18,4-7(13)14)11(19,20)9(2,16)17/h6,16-20H,3-5H2,1-2H3,(H2,12,15) |
| InChIKey | HIGRINBRAGHAEI-UHFFFAOYSA-N |
| XLogP | -3.40 |
| TPSA | 164.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|