C30H48O3 — CID 91492909
trans-(1R,3S)-5-[2-[(1R,3aS,7aR)-1-[(2R,5S)-6-hydroxy-6-methyl-5-propan-2-ylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 91492909) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is trans-(1R,3S)-5-[2-[(1R,3aS,7aR)-1-[(2R,5S)-6-hydroxy-6-methyl-5-propan-2-ylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S)-5-[2-[(1R,3aS,7aR)-1-[(2R,5S)-6-hydroxy-6-methyl-5-propan-2-ylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 91492909 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | trans-(1R,3S)-5-[2-[(1R,3aS,7aR)-1-[(2R,5S)-6-hydroxy-6-methyl-5-propan-2-ylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)[C@@H]([C@H](C)C=C[C@H](C(C)C)C(C)(C)O)CC[C@@H]23)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C30H48O3/c1-19(2)25(29(5,6)33)13-10-20(3)26-14-15-27-22(9-8-16-30(26,27)7)11-12-23-17-24(31)18-28(32)21(23)4/h10-13,19-20,24-28,31-33H,4,8-9,14-18H2,1-3,5-7H3/t20-,24-,25-,26-,27+,28+,30-/m1/s1 |
| InChIKey | IDNHDNUWCYZGTG-PVMJHQFVSA-N |
| XLogP | 6.36 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|