About 2-phenyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3-dihydro-2-benzazepine
2-phenyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3-dihydro-2-benzazepine (PubChem CID 91493193) has the molecular formula C21H16F3N3
and a molecular weight of 367.37 g/mol. Its IUPAC name is 2-phenyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3-dihydro-2-benzazepine.
Molecular Properties
| Compound Name | 2-phenyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3-dihydro-2-benzazepine |
| PubChem CID | 91493193 |
| Molecular Formula | C21H16F3N3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-phenyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3-dihydro-2-benzazepine |
| SMILES | FC(F)(F)c1ccc(-c2ccc3c(c2)CN(c2ccccc2)CC=C3)nn1 |
| InChI | InChI=1S/C21H16F3N3/c22-21(23,24)20-11-10-19(25-26-20)16-9-8-15-5-4-12-27(14-17(15)13-16)18-6-2-1-3-7-18/h1-11,13H,12,14H2 |
| InChIKey | WAJFPVKGSLNOGO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3-dihydro-2-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3-dihydro-2-benzazepine?
The IUPAC name of 2-phenyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3-dihydro-2-benzazepine (CID 91493193) is 2-phenyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3-dihydro-2-benzazepine.
What is the SMILES notation for 2-phenyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3-dihydro-2-benzazepine?
The canonical SMILES for 2-phenyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3-dihydro-2-benzazepine is FC(F)(F)c1ccc(-c2ccc3c(c2)CN(c2ccccc2)CC=C3)nn1.
What is the InChIKey of 2-phenyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3-dihydro-2-benzazepine?
The InChIKey is WAJFPVKGSLNOGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F3N3/c22-21(23,24)20-11-10-19(25-26-20)16-9-8-15-5-4-12-27(14-17(15)13-16)18-6-2-1-3-7-18/h1-11,13H,12,14H2.
What are the key properties of 2-phenyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3-dihydro-2-benzazepine?
2-phenyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3-dihydro-2-benzazepine has a molecular weight of 367.37 g/mol, XLogP of 5.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-8-[6-(trifluoromethyl)pyridazin-3-yl]-1,3-dihydro-2-benzazepine is sourced from PubChem (CID 91493193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).