About 7-prop-2-enylidene-3,7a-dihydro-2H-cyclopenta[b]pyran-5,6-dione
7-prop-2-enylidene-3,7a-dihydro-2H-cyclopenta[b]pyran-5,6-dione (PubChem CID 91493499) has the molecular formula C11H10O3
and a molecular weight of 190.20 g/mol. Its IUPAC name is 7-prop-2-enylidene-3,7a-dihydro-2H-cyclopenta[b]pyran-5,6-dione.
Molecular Properties
| Compound Name | 7-prop-2-enylidene-3,7a-dihydro-2H-cyclopenta[b]pyran-5,6-dione |
| PubChem CID | 91493499 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 7-prop-2-enylidene-3,7a-dihydro-2H-cyclopenta[b]pyran-5,6-dione |
| SMILES | C=CC=C1C(=O)C(=O)C2=CCCOC12 |
| InChI | InChI=1S/C11H10O3/c1-2-4-7-9(12)10(13)8-5-3-6-14-11(7)8/h2,4-5,11H,1,3,6H2 |
| InChIKey | ZTXPDDBBKMHSTJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 7-prop-2-enylidene-3,7a-dihydro-2H-cyclopenta[b]pyran-5,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-prop-2-enylidene-3,7a-dihydro-2H-cyclopenta[b]pyran-5,6-dione?
The IUPAC name of 7-prop-2-enylidene-3,7a-dihydro-2H-cyclopenta[b]pyran-5,6-dione (CID 91493499) is 7-prop-2-enylidene-3,7a-dihydro-2H-cyclopenta[b]pyran-5,6-dione.
What is the SMILES notation for 7-prop-2-enylidene-3,7a-dihydro-2H-cyclopenta[b]pyran-5,6-dione?
The canonical SMILES for 7-prop-2-enylidene-3,7a-dihydro-2H-cyclopenta[b]pyran-5,6-dione is C=CC=C1C(=O)C(=O)C2=CCCOC12.
What is the InChIKey of 7-prop-2-enylidene-3,7a-dihydro-2H-cyclopenta[b]pyran-5,6-dione?
The InChIKey is ZTXPDDBBKMHSTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3/c1-2-4-7-9(12)10(13)8-5-3-6-14-11(7)8/h2,4-5,11H,1,3,6H2.
What are the key properties of 7-prop-2-enylidene-3,7a-dihydro-2H-cyclopenta[b]pyran-5,6-dione?
7-prop-2-enylidene-3,7a-dihydro-2H-cyclopenta[b]pyran-5,6-dione has a molecular weight of 190.20 g/mol, XLogP of 0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-prop-2-enylidene-3,7a-dihydro-2H-cyclopenta[b]pyran-5,6-dione is sourced from PubChem (CID 91493499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).