About 2-cyclopentyl-N-[2,4-dichloro-3-(isoquinolin-5-yloxymethyl)phenyl]propanamide
2-cyclopentyl-N-[2,4-dichloro-3-(isoquinolin-5-yloxymethyl)phenyl]propanamide (PubChem CID 91494143) has the molecular formula C24H24Cl2N2O2
and a molecular weight of 443.37 g/mol. Its IUPAC name is 2-cyclopentyl-N-[2,4-dichloro-3-(isoquinolin-5-yloxymethyl)phenyl]propanamide.
Molecular Properties
| Compound Name | 2-cyclopentyl-N-[2,4-dichloro-3-(isoquinolin-5-yloxymethyl)phenyl]propanamide |
| PubChem CID | 91494143 |
| Molecular Formula | C24H24Cl2N2O2 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-cyclopentyl-N-[2,4-dichloro-3-(isoquinolin-5-yloxymethyl)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1ccc(Cl)c(COc2cccc3cnccc23)c1Cl)C1CCCC1 |
| InChI | InChI=1S/C24H24Cl2N2O2/c1-15(16-5-2-3-6-16)24(29)28-21-10-9-20(25)19(23(21)26)14-30-22-8-4-7-17-13-27-12-11-18(17)22/h4,7-13,15-16H,2-3,5-6,14H2,1H3,(H,28,29) |
| InChIKey | JUODMEAQIFKCSJ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopentyl-N-[2,4-dichloro-3-(isoquinolin-5-yloxymethyl)phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-N-[2,4-dichloro-3-(isoquinolin-5-yloxymethyl)phenyl]propanamide?
The IUPAC name of 2-cyclopentyl-N-[2,4-dichloro-3-(isoquinolin-5-yloxymethyl)phenyl]propanamide (CID 91494143) is 2-cyclopentyl-N-[2,4-dichloro-3-(isoquinolin-5-yloxymethyl)phenyl]propanamide.
What is the SMILES notation for 2-cyclopentyl-N-[2,4-dichloro-3-(isoquinolin-5-yloxymethyl)phenyl]propanamide?
The canonical SMILES for 2-cyclopentyl-N-[2,4-dichloro-3-(isoquinolin-5-yloxymethyl)phenyl]propanamide is CC(C(=O)Nc1ccc(Cl)c(COc2cccc3cnccc23)c1Cl)C1CCCC1.
What is the InChIKey of 2-cyclopentyl-N-[2,4-dichloro-3-(isoquinolin-5-yloxymethyl)phenyl]propanamide?
The InChIKey is JUODMEAQIFKCSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24Cl2N2O2/c1-15(16-5-2-3-6-16)24(29)28-21-10-9-20(25)19(23(21)26)14-30-22-8-4-7-17-13-27-12-11-18(17)22/h4,7-13,15-16H,2-3,5-6,14H2,1H3,(H,28,29).
What are the key properties of 2-cyclopentyl-N-[2,4-dichloro-3-(isoquinolin-5-yloxymethyl)phenyl]propanamide?
2-cyclopentyl-N-[2,4-dichloro-3-(isoquinolin-5-yloxymethyl)phenyl]propanamide has a molecular weight of 443.37 g/mol, XLogP of 6.89, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-N-[2,4-dichloro-3-(isoquinolin-5-yloxymethyl)phenyl]propanamide is sourced from PubChem (CID 91494143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).