C20H30 — CID 91494739
(10R,13S,14R)-7,10,13-trimethyl-4,5,6,7,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene (PubChem CID 91494739) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is (10R,13S,14R)-7,10,13-trimethyl-4,5,6,7,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene.
| Compound Name | (10R,13S,14R)-7,10,13-trimethyl-4,5,6,7,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 91494739 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | (10R,13S,14R)-7,10,13-trimethyl-4,5,6,7,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene |
| SMILES | CC1CC2CCC=C[C@]2(C)C2=C1[C@@H]1CCC[C@@]1(C)CC2 |
| InChI | InChI=1S/C20H30/c1-14-13-15-7-4-5-11-20(15,3)17-9-12-19(2)10-6-8-16(19)18(14)17/h5,11,14-16H,4,6-10,12-13H2,1-3H3/t14?,15?,16-,19-,20-/m0/s1 |
| InChIKey | FNFSHIBFLVMVND-AJHRRDMJSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|