C8H20O18P4 — CID 91494896
[(1R,3S,4S,6R)-2,5-dimethoxy-3,4,6-triphosphonooxycyclohexyl] dihydrogen phosphate (PubChem CID 91494896) has the molecular formula C8H20O18P4 and a molecular weight of 528.13 g/mol. Its IUPAC name is [(1R,3S,4S,6R)-2,5-dimethoxy-3,4,6-triphosphonooxycyclohexyl] dihydrogen phosphate.
| Compound Name | [(1R,3S,4S,6R)-2,5-dimethoxy-3,4,6-triphosphonooxycyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91494896 |
| Molecular Formula | C8H20O18P4 |
| Molecular Weight | 528.13 g/mol |
| Exact Mass | 527.96 |
| IUPAC Name | [(1R,3S,4S,6R)-2,5-dimethoxy-3,4,6-triphosphonooxycyclohexyl] dihydrogen phosphate |
| SMILES | COC1[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)C(OC)[C@H](OP(=O)(O)O)[C@H]1OP(=O)(O)O |
| InChI | InChI=1S/C8H20O18P4/c1-21-3-5(23-27(9,10)11)7(25-29(15,16)17)4(22-2)8(26-30(18,19)20)6(3)24-28(12,13)14/h3-8H,1-2H3,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20)/t3?,4?,5-,6+,7-,8+ |
| InChIKey | VJYLBTADOQLLGZ-SDIAGKKTSA-N |
| XLogP | -2.06 |
| TPSA | 285.50 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.13 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|