About (4R)-2,2-dimethyloxane-4-carbothioamide
(4R)-2,2-dimethyloxane-4-carbothioamide (PubChem CID 914949) has the molecular formula C8H15NOS
and a molecular weight of 173.28 g/mol. Its IUPAC name is (4R)-2,2-dimethyloxane-4-carbothioamide.
Molecular Properties
| Compound Name | (4R)-2,2-dimethyloxane-4-carbothioamide |
| PubChem CID | 914949 |
| Molecular Formula | C8H15NOS |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | (4R)-2,2-dimethyloxane-4-carbothioamide |
| SMILES | CC1(C)C[C@H](C(N)=S)CCO1 |
| InChI | InChI=1S/C8H15NOS/c1-8(2)5-6(7(9)11)3-4-10-8/h6H,3-5H2,1-2H3,(H2,9,11)/t6-/m1/s1 |
| InChIKey | CALPJUFDEFFSDI-ZCFIWIBFSA-N |
| XLogP | 1.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4R)-2,2-dimethyloxane-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,2-dimethyloxane-4-carbothioamide?
The IUPAC name of (4R)-2,2-dimethyloxane-4-carbothioamide (CID 914949) is (4R)-2,2-dimethyloxane-4-carbothioamide.
What is the SMILES notation for (4R)-2,2-dimethyloxane-4-carbothioamide?
The canonical SMILES for (4R)-2,2-dimethyloxane-4-carbothioamide is CC1(C)C[C@H](C(N)=S)CCO1.
What is the InChIKey of (4R)-2,2-dimethyloxane-4-carbothioamide?
The InChIKey is CALPJUFDEFFSDI-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H15NOS/c1-8(2)5-6(7(9)11)3-4-10-8/h6H,3-5H2,1-2H3,(H2,9,11)/t6-/m1/s1.
What are the key properties of (4R)-2,2-dimethyloxane-4-carbothioamide?
(4R)-2,2-dimethyloxane-4-carbothioamide has a molecular weight of 173.28 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,2-dimethyloxane-4-carbothioamide is sourced from PubChem (CID 914949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).