C23H32N6O7 — CID 91495077
tert-butyl N-[2-[[7-methyl-2,4-dioxo-10-(2,3,5-trihydroxypentyl)benzo[g]pteridin-8-yl]amino]ethyl]carbamate (PubChem CID 91495077) has the molecular formula C23H32N6O7 and a molecular weight of 504.54 g/mol. Its IUPAC name is tert-butyl N-[2-[[7-methyl-2,4-dioxo-10-(2,3,5-trihydroxypentyl)benzo[g]pteridin-8-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[7-methyl-2,4-dioxo-10-(2,3,5-trihydroxypentyl)benzo[g]pteridin-8-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 91495077 |
| Molecular Formula | C23H32N6O7 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | tert-butyl N-[2-[[7-methyl-2,4-dioxo-10-(2,3,5-trihydroxypentyl)benzo[g]pteridin-8-yl]amino]ethyl]carbamate |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC(O)C(O)CCO)c2cc1NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H32N6O7/c1-12-9-14-15(10-13(12)24-6-7-25-22(35)36-23(2,3)4)29(11-17(32)16(31)5-8-30)19-18(26-14)20(33)28-21(34)27-19/h9-10,16-17,24,30-32H,5-8,11H2,1-4H3,(H,25,35)(H,28,33,34) |
| InChIKey | YEIPEDWPNOIKCI-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 191.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|