About 1-(6-oxooctyl)pyrrole-2,5-dione
1-(6-oxooctyl)pyrrole-2,5-dione (PubChem CID 91495276) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is 1-(6-oxooctyl)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-(6-oxooctyl)pyrrole-2,5-dione |
| PubChem CID | 91495276 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 1-(6-oxooctyl)pyrrole-2,5-dione |
| SMILES | CCC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H17NO3/c1-2-10(14)6-4-3-5-9-13-11(15)7-8-12(13)16/h7-8H,2-6,9H2,1H3 |
| InChIKey | MURRWSHLLREBEU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-oxooctyl)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-oxooctyl)pyrrole-2,5-dione?
The IUPAC name of 1-(6-oxooctyl)pyrrole-2,5-dione (CID 91495276) is 1-(6-oxooctyl)pyrrole-2,5-dione.
What is the SMILES notation for 1-(6-oxooctyl)pyrrole-2,5-dione?
The canonical SMILES for 1-(6-oxooctyl)pyrrole-2,5-dione is CCC(=O)CCCCCN1C(=O)C=CC1=O.
What is the InChIKey of 1-(6-oxooctyl)pyrrole-2,5-dione?
The InChIKey is MURRWSHLLREBEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-2-10(14)6-4-3-5-9-13-11(15)7-8-12(13)16/h7-8H,2-6,9H2,1H3.
What are the key properties of 1-(6-oxooctyl)pyrrole-2,5-dione?
1-(6-oxooctyl)pyrrole-2,5-dione has a molecular weight of 223.27 g/mol, XLogP of 1.45, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-oxooctyl)pyrrole-2,5-dione is sourced from PubChem (CID 91495276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).