About N-(1,3-dichloro-4-methyl-2-prop-2-enylhexa-1,3-dienyl)ethanimine
N-(1,3-dichloro-4-methyl-2-prop-2-enylhexa-1,3-dienyl)ethanimine (PubChem CID 91495385) has the molecular formula C12H17Cl2N
and a molecular weight of 246.18 g/mol. Its IUPAC name is N-(1,3-dichloro-4-methyl-2-prop-2-enylhexa-1,3-dienyl)ethanimine.
Molecular Properties
| Compound Name | N-(1,3-dichloro-4-methyl-2-prop-2-enylhexa-1,3-dienyl)ethanimine |
| PubChem CID | 91495385 |
| Molecular Formula | C12H17Cl2N |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | N-(1,3-dichloro-4-methyl-2-prop-2-enylhexa-1,3-dienyl)ethanimine |
| SMILES | C=CCC(=C(Cl)N=CC)C(Cl)=C(C)CC |
| InChI | InChI=1S/C12H17Cl2N/c1-5-8-10(12(14)15-7-3)11(13)9(4)6-2/h5,7H,1,6,8H2,2-4H3 |
| InChIKey | VQIPHBCVNXKUHO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-dichloro-4-methyl-2-prop-2-enylhexa-1,3-dienyl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dichloro-4-methyl-2-prop-2-enylhexa-1,3-dienyl)ethanimine?
The IUPAC name of N-(1,3-dichloro-4-methyl-2-prop-2-enylhexa-1,3-dienyl)ethanimine (CID 91495385) is N-(1,3-dichloro-4-methyl-2-prop-2-enylhexa-1,3-dienyl)ethanimine.
What is the SMILES notation for N-(1,3-dichloro-4-methyl-2-prop-2-enylhexa-1,3-dienyl)ethanimine?
The canonical SMILES for N-(1,3-dichloro-4-methyl-2-prop-2-enylhexa-1,3-dienyl)ethanimine is C=CCC(=C(Cl)N=CC)C(Cl)=C(C)CC.
What is the InChIKey of N-(1,3-dichloro-4-methyl-2-prop-2-enylhexa-1,3-dienyl)ethanimine?
The InChIKey is VQIPHBCVNXKUHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Cl2N/c1-5-8-10(12(14)15-7-3)11(13)9(4)6-2/h5,7H,1,6,8H2,2-4H3.
What are the key properties of N-(1,3-dichloro-4-methyl-2-prop-2-enylhexa-1,3-dienyl)ethanimine?
N-(1,3-dichloro-4-methyl-2-prop-2-enylhexa-1,3-dienyl)ethanimine has a molecular weight of 246.18 g/mol, XLogP of 5.03, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dichloro-4-methyl-2-prop-2-enylhexa-1,3-dienyl)ethanimine is sourced from PubChem (CID 91495385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).