C22H26N2OS — CID 91495818
3-[2-[3-(1-benzothiophen-3-yl)-1H-pyrazol-5-yl]ethyl]-2,4,4-trimethylcyclohex-2-en-1-ol (PubChem CID 91495818) has the molecular formula C22H26N2OS and a molecular weight of 366.53 g/mol. Its IUPAC name is 3-[2-[3-(1-benzothiophen-3-yl)-1H-pyrazol-5-yl]ethyl]-2,4,4-trimethylcyclohex-2-en-1-ol.
| Compound Name | 3-[2-[3-(1-benzothiophen-3-yl)-1H-pyrazol-5-yl]ethyl]-2,4,4-trimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 91495818 |
| Molecular Formula | C22H26N2OS |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 3-[2-[3-(1-benzothiophen-3-yl)-1H-pyrazol-5-yl]ethyl]-2,4,4-trimethylcyclohex-2-en-1-ol |
| SMILES | CC1=C(CCc2cc(-c3csc4ccccc34)n[nH]2)C(C)(C)CCC1O |
| InChI | InChI=1S/C22H26N2OS/c1-14-18(22(2,3)11-10-20(14)25)9-8-15-12-19(24-23-15)17-13-26-21-7-5-4-6-16(17)21/h4-7,12-13,20,25H,8-11H2,1-3H3,(H,23,24) |
| InChIKey | NAINFSNMZDQVBG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|