C29H32BrN3O3 — CID 91495899
4-[4-[(4-aminophenyl)methoxy]-3-bromo-5-ethoxyphenyl]-2-methyl-5-oxo-7-propyl-4,6,7,8-tetrahydro-3H-quinoline-3-carbonitrile (PubChem CID 91495899) has the molecular formula C29H32BrN3O3 and a molecular weight of 550.50 g/mol. Its IUPAC name is 4-[4-[(4-aminophenyl)methoxy]-3-bromo-5-ethoxyphenyl]-2-methyl-5-oxo-7-propyl-4,6,7,8-tetrahydro-3H-quinoline-3-carbonitrile.
| Compound Name | 4-[4-[(4-aminophenyl)methoxy]-3-bromo-5-ethoxyphenyl]-2-methyl-5-oxo-7-propyl-4,6,7,8-tetrahydro-3H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 91495899 |
| Molecular Formula | C29H32BrN3O3 |
| Molecular Weight | 550.50 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 4-[4-[(4-aminophenyl)methoxy]-3-bromo-5-ethoxyphenyl]-2-methyl-5-oxo-7-propyl-4,6,7,8-tetrahydro-3H-quinoline-3-carbonitrile |
| SMILES | CCCC1CC(=O)C2=C(C1)N=C(C)C(C#N)C2c1cc(Br)c(OCc2ccc(N)cc2)c(OCC)c1 |
| InChI | InChI=1S/C29H32BrN3O3/c1-4-6-19-11-24-28(25(34)12-19)27(22(15-31)17(3)33-24)20-13-23(30)29(26(14-20)35-5-2)36-16-18-7-9-21(32)10-8-18/h7-10,13-14,19,22,27H,4-6,11-12,16,32H2,1-3H3 |
| InChIKey | RQBYOUMDEIOTAJ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.50 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|