C28H24Cl2N2O2 — CID 91496115
5-benzoyl-6-(2,4-dichlorophenyl)-9,9-dimethyl-6,6a,8,10-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 91496115) has the molecular formula C28H24Cl2N2O2 and a molecular weight of 491.42 g/mol. Its IUPAC name is 5-benzoyl-6-(2,4-dichlorophenyl)-9,9-dimethyl-6,6a,8,10-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-benzoyl-6-(2,4-dichlorophenyl)-9,9-dimethyl-6,6a,8,10-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 91496115 |
| Molecular Formula | C28H24Cl2N2O2 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 5-benzoyl-6-(2,4-dichlorophenyl)-9,9-dimethyl-6,6a,8,10-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2C(=Nc3ccccc3N(C(=O)c3ccccc3)C2c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C28H24Cl2N2O2/c1-28(2)15-22-25(24(33)16-28)26(19-13-12-18(29)14-20(19)30)32(23-11-7-6-10-21(23)31-22)27(34)17-8-4-3-5-9-17/h3-14,25-26H,15-16H2,1-2H3 |
| InChIKey | NTGOEOVPXRKJAO-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |