C10H22F3NO6S2 — CID 91496172
azanium 3-methyl-5-methylsulfonyl-3-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonate (PubChem CID 91496172) has the molecular formula C10H22F3NO6S2 and a molecular weight of 373.42 g/mol. Its IUPAC name is azanium 3-methyl-5-methylsulfonyl-3-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonate.
| Compound Name | azanium 3-methyl-5-methylsulfonyl-3-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonate |
|---|---|
| PubChem CID | 91496172 |
| Molecular Formula | C10H22F3NO6S2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | azanium 3-methyl-5-methylsulfonyl-3-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonate |
| SMILES | CC(CCS(C)(=O)=O)(CCS(=O)(=O)[O-])COCC(F)(F)F.[NH4+] |
| InChI | InChI=1S/C10H19F3O6S2.H3N/c1-9(3-5-20(2,14)15,4-6-21(16,17)18)7-19-8-10(11,12)13;/h3-8H2,1-2H3,(H,16,17,18);1H3 |
| InChIKey | BZVBBTXLVVTHJV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|