About 2,4,4-triaminobutanal
2,4,4-triaminobutanal (PubChem CID 91496808) has the molecular formula C4H11N3O
and a molecular weight of 117.15 g/mol. Its IUPAC name is 2,4,4-triaminobutanal.
Molecular Properties
| Compound Name | 2,4,4-triaminobutanal |
| PubChem CID | 91496808 |
| Molecular Formula | C4H11N3O |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.09 |
| IUPAC Name | 2,4,4-triaminobutanal |
| SMILES | NC(N)CC(N)C=O |
| InChI | InChI=1S/C4H11N3O/c5-3(2-8)1-4(6)7/h2-4H,1,5-7H2 |
| InChIKey | LQAMTGIGGBBGPJ-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,4,4-triaminobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,4-triaminobutanal?
The IUPAC name of 2,4,4-triaminobutanal (CID 91496808) is 2,4,4-triaminobutanal.
What is the SMILES notation for 2,4,4-triaminobutanal?
The canonical SMILES for 2,4,4-triaminobutanal is NC(N)CC(N)C=O.
What is the InChIKey of 2,4,4-triaminobutanal?
The InChIKey is LQAMTGIGGBBGPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3O/c5-3(2-8)1-4(6)7/h2-4H,1,5-7H2.
What are the key properties of 2,4,4-triaminobutanal?
2,4,4-triaminobutanal has a molecular weight of 117.15 g/mol, XLogP of -1.85, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,4-triaminobutanal is sourced from PubChem (CID 91496808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).