C9H11F3O3S — CID 91496907
3-cyclohexa-2,4-dien-1-yl-1,1,1-trifluoropropane-2-sulfonic acid (PubChem CID 91496907) has the molecular formula C9H11F3O3S and a molecular weight of 256.25 g/mol. Its IUPAC name is 3-cyclohexa-2,4-dien-1-yl-1,1,1-trifluoropropane-2-sulfonic acid.
| Compound Name | 3-cyclohexa-2,4-dien-1-yl-1,1,1-trifluoropropane-2-sulfonic acid |
|---|---|
| PubChem CID | 91496907 |
| Molecular Formula | C9H11F3O3S |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 3-cyclohexa-2,4-dien-1-yl-1,1,1-trifluoropropane-2-sulfonic acid |
| SMILES | O=S(=O)(O)C(CC1C=CC=CC1)C(F)(F)F |
| InChI | InChI=1S/C9H11F3O3S/c10-9(11,12)8(16(13,14)15)6-7-4-2-1-3-5-7/h1-4,7-8H,5-6H2,(H,13,14,15) |
| InChIKey | YLLOXMGDOXHKDR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|