C41H28O5 — CID 91497188
6-[10-(4-methylphenyl)-9-phenanthren-2-ylanthracen-2-yl]benzene-1,2,3,4,5-pentol (PubChem CID 91497188) has the molecular formula C41H28O5 and a molecular weight of 600.67 g/mol. Its IUPAC name is 6-[10-(4-methylphenyl)-9-phenanthren-2-ylanthracen-2-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[10-(4-methylphenyl)-9-phenanthren-2-ylanthracen-2-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 91497188 |
| Molecular Formula | C41H28O5 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.19 |
| IUPAC Name | 6-[10-(4-methylphenyl)-9-phenanthren-2-ylanthracen-2-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Cc1ccc(-c2c3ccccc3c(-c3ccc4c(ccc5ccccc54)c3)c3cc(-c4c(O)c(O)c(O)c(O)c4O)ccc23)cc1 |
| InChI | InChI=1S/C41H28O5/c1-22-10-12-24(13-11-22)34-30-8-4-5-9-31(30)35(26-16-18-29-25(20-26)15-14-23-6-2-3-7-28(23)29)33-21-27(17-19-32(33)34)36-37(42)39(44)41(46)40(45)38(36)43/h2-21,42-46H,1H3 |
| InChIKey | WVYCRKHMEOHAEF-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|