About 2-methylpenta-1,4-dien-3-imine
2-methylpenta-1,4-dien-3-imine (PubChem CID 91497636) has the molecular formula C6H9N
and a molecular weight of 95.14 g/mol. Its IUPAC name is 2-methylpenta-1,4-dien-3-imine.
Molecular Properties
| Compound Name | 2-methylpenta-1,4-dien-3-imine |
| PubChem CID | 91497636 |
| Molecular Formula | C6H9N |
| Molecular Weight | 95.14 g/mol |
| Exact Mass | 95.07 |
| IUPAC Name | 2-methylpenta-1,4-dien-3-imine |
| SMILES | [H]/N=C(\C=C)C(=C)C |
| InChI | InChI=1S/C6H9N/c1-4-6(7)5(2)3/h4,7H,1-2H2,3H3/b7-6+ |
| InChIKey | OOESRSDBHZWNGV-VOTSOKGWSA-N |
| XLogP | 1.77 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.14 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpenta-1,4-dien-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpenta-1,4-dien-3-imine?
The IUPAC name of 2-methylpenta-1,4-dien-3-imine (CID 91497636) is 2-methylpenta-1,4-dien-3-imine.
What is the SMILES notation for 2-methylpenta-1,4-dien-3-imine?
The canonical SMILES for 2-methylpenta-1,4-dien-3-imine is [H]/N=C(\C=C)C(=C)C.
What is the InChIKey of 2-methylpenta-1,4-dien-3-imine?
The InChIKey is OOESRSDBHZWNGV-VOTSOKGWSA-N. The full InChI is InChI=1S/C6H9N/c1-4-6(7)5(2)3/h4,7H,1-2H2,3H3/b7-6+.
What are the key properties of 2-methylpenta-1,4-dien-3-imine?
2-methylpenta-1,4-dien-3-imine has a molecular weight of 95.14 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpenta-1,4-dien-3-imine is sourced from PubChem (CID 91497636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).