C48H84N2O6 — CID 91497888
bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate;ethyl 3-(3,5-ditert-butyl-4-methylphenyl)propanoate (PubChem CID 91497888) has the molecular formula C48H84N2O6 and a molecular weight of 785.21 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate;ethyl 3-(3,5-ditert-butyl-4-methylphenyl)propanoate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate;ethyl 3-(3,5-ditert-butyl-4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 91497888 |
| Molecular Formula | C48H84N2O6 |
| Molecular Weight | 785.21 g/mol |
| Exact Mass | 784.63 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate;ethyl 3-(3,5-ditert-butyl-4-methylphenyl)propanoate |
| SMILES | CC1(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1.CCOC(=O)CCc1cc(C(C)(C)C)c(C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H52N2O4.C20H32O2/c1-25(2)17-21(18-26(3,4)29-25)33-23(31)15-13-11-9-10-12-14-16-24(32)34-22-19-27(5,6)30-28(7,8)20-22;1-9-22-18(21)11-10-15-12-16(19(3,4)5)14(2)17(13-15)20(6,7)8/h21-22,29-30H,9-20H2,1-8H3;12-13H,9-11H2,1-8H3 |
| InChIKey | GOCFEMSZVSPXSP-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.21 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|