C14H25NO6 — CID 91497944
2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]octanedioic acid (PubChem CID 91497944) has the molecular formula C14H25NO6 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]octanedioic acid.
| Compound Name | 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]octanedioic acid |
|---|---|
| PubChem CID | 91497944 |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]octanedioic acid |
| SMILES | CC(C)(C)OC(=O)CNC(CCCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H25NO6/c1-14(2,3)21-12(18)9-15-10(13(19)20)7-5-4-6-8-11(16)17/h10,15H,4-9H2,1-3H3,(H,16,17)(H,19,20) |
| InChIKey | MPOOABSGQUQLRW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|