C19H13F3N2O4 — CID 91497948
7-[(4S,7R)-1,3-dihydroxy-4,7-dihydro-4,7-epoxyisoindol-2-yl]-8-methyl-4-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 91497948) has the molecular formula C19H13F3N2O4 and a molecular weight of 390.32 g/mol. Its IUPAC name is 7-[(4S,7R)-1,3-dihydroxy-4,7-dihydro-4,7-epoxyisoindol-2-yl]-8-methyl-4-(trifluoromethyl)-1H-quinolin-2-one.
| Compound Name | 7-[(4S,7R)-1,3-dihydroxy-4,7-dihydro-4,7-epoxyisoindol-2-yl]-8-methyl-4-(trifluoromethyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 91497948 |
| Molecular Formula | C19H13F3N2O4 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 7-[(4S,7R)-1,3-dihydroxy-4,7-dihydro-4,7-epoxyisoindol-2-yl]-8-methyl-4-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | Cc1c(-n2c(O)c3c(c2O)[C@H]2C=C[C@@H]3O2)ccc2c(C(F)(F)F)cc(=O)[nH]c12 |
| InChI | InChI=1S/C19H13F3N2O4/c1-7-10(3-2-8-9(19(20,21)22)6-13(25)23-16(7)8)24-17(26)14-11-4-5-12(28-11)15(14)18(24)27/h2-6,11-12,26-27H,1H3,(H,23,25)/t11-,12+ |
| InChIKey | WSSVADYVSHZWIC-TXEJJXNPSA-N |
| XLogP | 3.74 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|