C20H24F3N3O5 — CID 91498229
2-[1-[[2-[4-(trifluoromethoxy)phenoxy]acetyl]amino]heptyl]-1,3-oxazole-4-carboxamide (PubChem CID 91498229) has the molecular formula C20H24F3N3O5 and a molecular weight of 443.42 g/mol. Its IUPAC name is 2-[1-[[2-[4-(trifluoromethoxy)phenoxy]acetyl]amino]heptyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[1-[[2-[4-(trifluoromethoxy)phenoxy]acetyl]amino]heptyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 91498229 |
| Molecular Formula | C20H24F3N3O5 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-[1-[[2-[4-(trifluoromethoxy)phenoxy]acetyl]amino]heptyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCCC(NC(=O)COc1ccc(OC(F)(F)F)cc1)c1nc(C(N)=O)co1 |
| InChI | InChI=1S/C20H24F3N3O5/c1-2-3-4-5-6-15(19-26-16(11-30-19)18(24)28)25-17(27)12-29-13-7-9-14(10-8-13)31-20(21,22)23/h7-11,15H,2-6,12H2,1H3,(H2,24,28)(H,25,27) |
| InChIKey | ZSGGLGTUCLARSD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|