C18H17ClN2O3S2 — CID 91498344
5-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-2-hydroxy-3-methylpent-4-ynethioamide (PubChem CID 91498344) has the molecular formula C18H17ClN2O3S2 and a molecular weight of 408.93 g/mol. Its IUPAC name is 5-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-2-hydroxy-3-methylpent-4-ynethioamide.
| Compound Name | 5-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-2-hydroxy-3-methylpent-4-ynethioamide |
|---|---|
| PubChem CID | 91498344 |
| Molecular Formula | C18H17ClN2O3S2 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 5-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-2-hydroxy-3-methylpent-4-ynethioamide |
| SMILES | CC(C#Cc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1)C(O)C(N)=S |
| InChI | InChI=1S/C18H17ClN2O3S2/c1-12(17(22)18(20)25)2-3-13-4-10-16(11-5-13)26(23,24)21-15-8-6-14(19)7-9-15/h4-12,17,21-22H,1H3,(H2,20,25) |
| InChIKey | BWNKQNLDPSWDOP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|