C18H18FNO2S — CID 91498641
3-(2-ethyl-4,5-dimethoxyphenyl)sulfanyl-6-fluoro-1H-indole (PubChem CID 91498641) has the molecular formula C18H18FNO2S and a molecular weight of 331.41 g/mol. Its IUPAC name is 3-(2-ethyl-4,5-dimethoxyphenyl)sulfanyl-6-fluoro-1H-indole.
| Compound Name | 3-(2-ethyl-4,5-dimethoxyphenyl)sulfanyl-6-fluoro-1H-indole |
|---|---|
| PubChem CID | 91498641 |
| Molecular Formula | C18H18FNO2S |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-(2-ethyl-4,5-dimethoxyphenyl)sulfanyl-6-fluoro-1H-indole |
| SMILES | CCc1cc(OC)c(OC)cc1Sc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C18H18FNO2S/c1-4-11-7-15(21-2)16(22-3)9-17(11)23-18-10-20-14-8-12(19)5-6-13(14)18/h5-10,20H,4H2,1-3H3 |
| InChIKey | GNTGWHJDCIZWHF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |