C40H41BN2O2 — CID 91498762
3-[3-[3-[3-(3,4-dihydropyridin-5-yl)phenyl]-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,3-dien-1-yl]cyclohexa-2,4-dien-1-yl]phenyl]pyridine (PubChem CID 91498762) has the molecular formula C40H41BN2O2 and a molecular weight of 592.59 g/mol. Its IUPAC name is 3-[3-[3-[3-(3,4-dihydropyridin-5-yl)phenyl]-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,3-dien-1-yl]cyclohexa-2,4-dien-1-yl]phenyl]pyridine.
| Compound Name | 3-[3-[3-[3-(3,4-dihydropyridin-5-yl)phenyl]-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,3-dien-1-yl]cyclohexa-2,4-dien-1-yl]phenyl]pyridine |
|---|---|
| PubChem CID | 91498762 |
| Molecular Formula | C40H41BN2O2 |
| Molecular Weight | 592.59 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | 3-[3-[3-[3-(3,4-dihydropyridin-5-yl)phenyl]-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-1,3-dien-1-yl]cyclohexa-2,4-dien-1-yl]phenyl]pyridine |
| SMILES | CC1(C)OB(C2=CCCC(C3=CC(c4cccc(C5=CN=CCC5)c4)=CC(c4cccc(-c5cccnc5)c4)C3)=C2)OC1(C)C |
| InChI | InChI=1S/C40H41BN2O2/c1-39(2)40(3,4)45-41(44-39)38-17-7-14-32(25-38)37-23-35(30-12-5-10-28(20-30)33-15-8-18-42-26-33)22-36(24-37)31-13-6-11-29(21-31)34-16-9-19-43-27-34/h5-6,8,10-13,15,17-22,24-27,35H,7,9,14,16,23H2,1-4H3 |
| InChIKey | XQZCBIZILLMUEB-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.59 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|