About acetyloxy 2-[1-benzyl-4-[4-(trifluoromethyl)phenyl]indol-3-yl]butaneperoxoate
acetyloxy 2-[1-benzyl-4-[4-(trifluoromethyl)phenyl]indol-3-yl]butaneperoxoate (PubChem CID 91498889) has the molecular formula C28H24F3NO5
and a molecular weight of 511.50 g/mol. Its IUPAC name is acetyloxy 2-[1-benzyl-4-[4-(trifluoromethyl)phenyl]indol-3-yl]butaneperoxoate.
Molecular Properties
| Compound Name | acetyloxy 2-[1-benzyl-4-[4-(trifluoromethyl)phenyl]indol-3-yl]butaneperoxoate |
| PubChem CID | 91498889 |
| Molecular Formula | C28H24F3NO5 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | acetyloxy 2-[1-benzyl-4-[4-(trifluoromethyl)phenyl]indol-3-yl]butaneperoxoate |
| SMILES | CCC(C(=O)OOOC(C)=O)c1cn(Cc2ccccc2)c2cccc(-c3ccc(C(F)(F)F)cc3)c12 |
| InChI | InChI=1S/C28H24F3NO5/c1-3-22(27(34)36-37-35-18(2)33)24-17-32(16-19-8-5-4-6-9-19)25-11-7-10-23(26(24)25)20-12-14-21(15-13-20)28(29,30)31/h4-15,17,22H,3,16H2,1-2H3 |
| InChIKey | SRPAYHBGWJMGIJ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze acetyloxy 2-[1-benzyl-4-[4-(trifluoromethyl)phenyl]indol-3-yl]butaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyloxy 2-[1-benzyl-4-[4-(trifluoromethyl)phenyl]indol-3-yl]butaneperoxoate?
The IUPAC name of acetyloxy 2-[1-benzyl-4-[4-(trifluoromethyl)phenyl]indol-3-yl]butaneperoxoate (CID 91498889) is acetyloxy 2-[1-benzyl-4-[4-(trifluoromethyl)phenyl]indol-3-yl]butaneperoxoate.
What is the SMILES notation for acetyloxy 2-[1-benzyl-4-[4-(trifluoromethyl)phenyl]indol-3-yl]butaneperoxoate?
The canonical SMILES for acetyloxy 2-[1-benzyl-4-[4-(trifluoromethyl)phenyl]indol-3-yl]butaneperoxoate is CCC(C(=O)OOOC(C)=O)c1cn(Cc2ccccc2)c2cccc(-c3ccc(C(F)(F)F)cc3)c12.
What is the InChIKey of acetyloxy 2-[1-benzyl-4-[4-(trifluoromethyl)phenyl]indol-3-yl]butaneperoxoate?
The InChIKey is SRPAYHBGWJMGIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24F3NO5/c1-3-22(27(34)36-37-35-18(2)33)24-17-32(16-19-8-5-4-6-9-19)25-11-7-10-23(26(24)25)20-12-14-21(15-13-20)28(29,30)31/h4-15,17,22H,3,16H2,1-2H3.
What are the key properties of acetyloxy 2-[1-benzyl-4-[4-(trifluoromethyl)phenyl]indol-3-yl]butaneperoxoate?
acetyloxy 2-[1-benzyl-4-[4-(trifluoromethyl)phenyl]indol-3-yl]butaneperoxoate has a molecular weight of 511.50 g/mol, XLogP of 6.82, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetyloxy 2-[1-benzyl-4-[4-(trifluoromethyl)phenyl]indol-3-yl]butaneperoxoate is sourced from PubChem (CID 91498889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).