C25H42O5 — CID 91499075
(2-acetyl-2-methyl-1,3-dioxan-5-yl) octadeca-9,12-dienoate (PubChem CID 91499075) has the molecular formula C25H42O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is (2-acetyl-2-methyl-1,3-dioxan-5-yl) octadeca-9,12-dienoate.
| Compound Name | (2-acetyl-2-methyl-1,3-dioxan-5-yl) octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 91499075 |
| Molecular Formula | C25H42O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | (2-acetyl-2-methyl-1,3-dioxan-5-yl) octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OC1COC(C)(C(C)=O)OC1 |
| InChI | InChI=1S/C25H42O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(27)30-23-20-28-25(3,22(2)26)29-21-23/h8-9,11-12,23H,4-7,10,13-21H2,1-3H3 |
| InChIKey | JXENHIVIBLGPFV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|