C41H78 — CID 91499123
2-butan-2-yl-5-(2,3,3,4,4,5,5,6,6,7,7,8-dodecamethylnonan-2-yl)-2,3,4,4,5,8-hexamethyltricyclo[4.3.1.03,9]decane (PubChem CID 91499123) has the molecular formula C41H78 and a molecular weight of 571.08 g/mol. Its IUPAC name is 2-butan-2-yl-5-(2,3,3,4,4,5,5,6,6,7,7,8-dodecamethylnonan-2-yl)-2,3,4,4,5,8-hexamethyltricyclo[4.3.1.03,9]decane.
| Compound Name | 2-butan-2-yl-5-(2,3,3,4,4,5,5,6,6,7,7,8-dodecamethylnonan-2-yl)-2,3,4,4,5,8-hexamethyltricyclo[4.3.1.03,9]decane |
|---|---|
| PubChem CID | 91499123 |
| Molecular Formula | C41H78 |
| Molecular Weight | 571.08 g/mol |
| Exact Mass | 570.61 |
| IUPAC Name | 2-butan-2-yl-5-(2,3,3,4,4,5,5,6,6,7,7,8-dodecamethylnonan-2-yl)-2,3,4,4,5,8-hexamethyltricyclo[4.3.1.03,9]decane |
| SMILES | CCC(C)C1(C)C2CC3CC(C)C2C1(C)C(C)(C)C3(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C41H78/c1-23-28(5)39(20)30-25-29-24-27(4)31(30)41(39,22)38(18,19)40(29,21)37(16,17)36(14,15)35(12,13)34(10,11)33(8,9)32(6,7)26(2)3/h26-31H,23-25H2,1-22H3 |
| InChIKey | SOVGLEICUHGISW-UHFFFAOYSA-N |
| XLogP | 13.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.08 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |