C11H18O2 — CID 91499284
2-(3-methylbutan-2-yl)cyclohexane-1,4-dione (PubChem CID 91499284) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 2-(3-methylbutan-2-yl)cyclohexane-1,4-dione.
| Compound Name | 2-(3-methylbutan-2-yl)cyclohexane-1,4-dione |
|---|---|
| PubChem CID | 91499284 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2-(3-methylbutan-2-yl)cyclohexane-1,4-dione |
| SMILES | CC(C)C(C)C1CC(=O)CCC1=O |
| InChI | InChI=1S/C11H18O2/c1-7(2)8(3)10-6-9(12)4-5-11(10)13/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | VSGUMIXOVWVOMW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |