About 4-butan-2-yl-1,2-dimethyl-7-(5-methylthiolan-2-yl)azepane
4-butan-2-yl-1,2-dimethyl-7-(5-methylthiolan-2-yl)azepane (PubChem CID 91499363) has the molecular formula C17H33NS
and a molecular weight of 283.52 g/mol. Its IUPAC name is 4-butan-2-yl-1,2-dimethyl-7-(5-methylthiolan-2-yl)azepane.
Molecular Properties
| Compound Name | 4-butan-2-yl-1,2-dimethyl-7-(5-methylthiolan-2-yl)azepane |
| PubChem CID | 91499363 |
| Molecular Formula | C17H33NS |
| Molecular Weight | 283.52 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 4-butan-2-yl-1,2-dimethyl-7-(5-methylthiolan-2-yl)azepane |
| SMILES | CCC(C)C1CCC(C2CCC(C)S2)N(C)C(C)C1 |
| InChI | InChI=1S/C17H33NS/c1-6-12(2)15-8-9-16(18(5)13(3)11-15)17-10-7-14(4)19-17/h12-17H,6-11H2,1-5H3 |
| InChIKey | HDINAYHMDUOJBW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-butan-2-yl-1,2-dimethyl-7-(5-methylthiolan-2-yl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yl-1,2-dimethyl-7-(5-methylthiolan-2-yl)azepane?
The IUPAC name of 4-butan-2-yl-1,2-dimethyl-7-(5-methylthiolan-2-yl)azepane (CID 91499363) is 4-butan-2-yl-1,2-dimethyl-7-(5-methylthiolan-2-yl)azepane.
What is the SMILES notation for 4-butan-2-yl-1,2-dimethyl-7-(5-methylthiolan-2-yl)azepane?
The canonical SMILES for 4-butan-2-yl-1,2-dimethyl-7-(5-methylthiolan-2-yl)azepane is CCC(C)C1CCC(C2CCC(C)S2)N(C)C(C)C1.
What is the InChIKey of 4-butan-2-yl-1,2-dimethyl-7-(5-methylthiolan-2-yl)azepane?
The InChIKey is HDINAYHMDUOJBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33NS/c1-6-12(2)15-8-9-16(18(5)13(3)11-15)17-10-7-14(4)19-17/h12-17H,6-11H2,1-5H3.
What are the key properties of 4-butan-2-yl-1,2-dimethyl-7-(5-methylthiolan-2-yl)azepane?
4-butan-2-yl-1,2-dimethyl-7-(5-methylthiolan-2-yl)azepane has a molecular weight of 283.52 g/mol, XLogP of 4.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-1,2-dimethyl-7-(5-methylthiolan-2-yl)azepane is sourced from PubChem (CID 91499363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).